C24H30BrN3O2 — CID 93324177
2-[4-[(3-bromobenzoyl)amino]piperidin-1-yl]-N-[(2S)-3-methylbutan-2-yl]benzamide (PubChem CID 93324177) has the molecular formula C24H30BrN3O2 and a molecular weight of 472.43 g/mol. Its IUPAC name is 2-[4-[(3-bromobenzoyl)amino]piperidin-1-yl]-N-[(2S)-3-methylbutan-2-yl]benzamide.
| Compound Name | 2-[4-[(3-bromobenzoyl)amino]piperidin-1-yl]-N-[(2S)-3-methylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 93324177 |
| Molecular Formula | C24H30BrN3O2 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 2-[4-[(3-bromobenzoyl)amino]piperidin-1-yl]-N-[(2S)-3-methylbutan-2-yl]benzamide |
| SMILES | CC(C)[C@H](C)NC(=O)c1ccccc1N1CCC(NC(=O)c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C24H30BrN3O2/c1-16(2)17(3)26-24(30)21-9-4-5-10-22(21)28-13-11-20(12-14-28)27-23(29)18-7-6-8-19(25)15-18/h4-10,15-17,20H,11-14H2,1-3H3,(H,26,30)(H,27,29)/t17-/m0/s1 |
| InChIKey | CMYJUHMVYLCHFK-KRWDZBQOSA-N |
| XLogP | 4.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |