C21H32N4O2 — CID 46038598
N-(3-methylbutan-2-yl)-2-[4-(prop-2-enylcarbamoylamino)piperidin-1-yl]benzamide (PubChem CID 46038598) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-(3-methylbutan-2-yl)-2-[4-(prop-2-enylcarbamoylamino)piperidin-1-yl]benzamide.
| Compound Name | N-(3-methylbutan-2-yl)-2-[4-(prop-2-enylcarbamoylamino)piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 46038598 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | N-(3-methylbutan-2-yl)-2-[4-(prop-2-enylcarbamoylamino)piperidin-1-yl]benzamide |
| SMILES | C=CCNC(=O)NC1CCN(c2ccccc2C(=O)NC(C)C(C)C)CC1 |
| InChI | InChI=1S/C21H32N4O2/c1-5-12-22-21(27)24-17-10-13-25(14-11-17)19-9-7-6-8-18(19)20(26)23-16(4)15(2)3/h5-9,15-17H,1,10-14H2,2-4H3,(H,23,26)(H2,22,24,27) |
| InChIKey | SXOHFUCBDYHEPC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|