C23H30BrIN2O — CID 87792036
[4-[[(3-bromobenzoyl)amino]methyl]phenyl]methyl-cyclohexyl-dimethylazanium iodide (PubChem CID 87792036) has the molecular formula C23H30BrIN2O and a molecular weight of 557.31 g/mol. Its IUPAC name is [4-[[(3-bromobenzoyl)amino]methyl]phenyl]methyl-cyclohexyl-dimethylazanium iodide.
| Compound Name | [4-[[(3-bromobenzoyl)amino]methyl]phenyl]methyl-cyclohexyl-dimethylazanium iodide |
|---|---|
| PubChem CID | 87792036 |
| Molecular Formula | C23H30BrIN2O |
| Molecular Weight | 557.31 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | [4-[[(3-bromobenzoyl)amino]methyl]phenyl]methyl-cyclohexyl-dimethylazanium iodide |
| SMILES | C[N+](C)(Cc1ccc(CNC(=O)c2cccc(Br)c2)cc1)C1CCCCC1.[I-] |
| InChI | InChI=1S/C23H29BrN2O.HI/c1-26(2,22-9-4-3-5-10-22)17-19-13-11-18(12-14-19)16-25-23(27)20-7-6-8-21(24)15-20;/h6-8,11-15,22H,3-5,9-10,16-17H2,1-2H3;1H |
| InChIKey | OKNRLCOSQMPQTR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|