C24H30FN2O+ — CID 74440477
cyclohexyl-[[3-[3-(4-fluorophenyl)prop-2-enoylamino]phenyl]methyl]-dimethylazanium (PubChem CID 74440477) has the molecular formula C24H30FN2O+ and a molecular weight of 381.52 g/mol. Its IUPAC name is cyclohexyl-[[3-[3-(4-fluorophenyl)prop-2-enoylamino]phenyl]methyl]-dimethylazanium.
| Compound Name | cyclohexyl-[[3-[3-(4-fluorophenyl)prop-2-enoylamino]phenyl]methyl]-dimethylazanium |
|---|---|
| PubChem CID | 74440477 |
| Molecular Formula | C24H30FN2O+ |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | cyclohexyl-[[3-[3-(4-fluorophenyl)prop-2-enoylamino]phenyl]methyl]-dimethylazanium |
| SMILES | C[N+](C)(Cc1cccc(NC(=O)C=Cc2ccc(F)cc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C24H29FN2O/c1-27(2,23-9-4-3-5-10-23)18-20-7-6-8-22(17-20)26-24(28)16-13-19-11-14-21(25)15-12-19/h6-8,11-17,23H,3-5,9-10,18H2,1-2H3/p+1 |
| InChIKey | NIJHPNNKGDDKBW-UHFFFAOYSA-O |
| XLogP | 5.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|