C23H28FN2O+ — CID 143173912
cyclohexyl-[[3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]phenyl]methyl]-methylazanium (PubChem CID 143173912) has the molecular formula C23H28FN2O+ and a molecular weight of 367.49 g/mol. Its IUPAC name is cyclohexyl-[[3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]phenyl]methyl]-methylazanium.
| Compound Name | cyclohexyl-[[3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]phenyl]methyl]-methylazanium |
|---|---|
| PubChem CID | 143173912 |
| Molecular Formula | C23H28FN2O+ |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | cyclohexyl-[[3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]phenyl]methyl]-methylazanium |
| SMILES | C[NH+](Cc1cccc(NC(=O)/C=C/c2ccc(F)cc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C23H27FN2O/c1-26(22-8-3-2-4-9-22)17-19-6-5-7-21(16-19)25-23(27)15-12-18-10-13-20(24)14-11-18/h5-7,10-16,22H,2-4,8-9,17H2,1H3,(H,25,27)/p+1/b15-12+ |
| InChIKey | FULPGVIATOEHMG-NTCAYCPXSA-O |
| XLogP | 3.83 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|