C33H39N2O3+ — CID 18472354
[4-[[7-(4-ethylphenyl)-2,3-dihydro-1-benzoxepine-4-carbonyl]amino]phenyl]methyl-dimethyl-(oxan-4-yl)azanium (PubChem CID 18472354) has the molecular formula C33H39N2O3+ and a molecular weight of 511.69 g/mol. Its IUPAC name is [4-[[7-(4-ethylphenyl)-2,3-dihydro-1-benzoxepine-4-carbonyl]amino]phenyl]methyl-dimethyl-(oxan-4-yl)azanium.
| Compound Name | [4-[[7-(4-ethylphenyl)-2,3-dihydro-1-benzoxepine-4-carbonyl]amino]phenyl]methyl-dimethyl-(oxan-4-yl)azanium |
|---|---|
| PubChem CID | 18472354 |
| Molecular Formula | C33H39N2O3+ |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | [4-[[7-(4-ethylphenyl)-2,3-dihydro-1-benzoxepine-4-carbonyl]amino]phenyl]methyl-dimethyl-(oxan-4-yl)azanium |
| SMILES | CCc1ccc(-c2ccc3c(c2)C=C(C(=O)Nc2ccc(C[N+](C)(C)C4CCOCC4)cc2)CCO3)cc1 |
| InChI | InChI=1S/C33H38N2O3/c1-4-24-5-9-26(10-6-24)27-11-14-32-29(21-27)22-28(15-20-38-32)33(36)34-30-12-7-25(8-13-30)23-35(2,3)31-16-18-37-19-17-31/h5-14,21-22,31H,4,15-20,23H2,1-3H3/p+1 |
| InChIKey | ZBSBANYHYAYTNK-UHFFFAOYSA-O |
| XLogP | 6.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|