C26H33N2O2+ — CID 25270878
cyclohexyl-dimethyl-[[4-[(6-methyl-2H-chromene-3-carbonyl)amino]phenyl]methyl]azanium (PubChem CID 25270878) has the molecular formula C26H33N2O2+ and a molecular weight of 405.56 g/mol. Its IUPAC name is cyclohexyl-dimethyl-[[4-[(6-methyl-2H-chromene-3-carbonyl)amino]phenyl]methyl]azanium.
| Compound Name | cyclohexyl-dimethyl-[[4-[(6-methyl-2H-chromene-3-carbonyl)amino]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 25270878 |
| Molecular Formula | C26H33N2O2+ |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | cyclohexyl-dimethyl-[[4-[(6-methyl-2H-chromene-3-carbonyl)amino]phenyl]methyl]azanium |
| SMILES | Cc1ccc2c(c1)C=C(C(=O)Nc1ccc(C[N+](C)(C)C3CCCCC3)cc1)CO2 |
| InChI | InChI=1S/C26H32N2O2/c1-19-9-14-25-21(15-19)16-22(18-30-25)26(29)27-23-12-10-20(11-13-23)17-28(2,3)24-7-5-4-6-8-24/h9-16,24H,4-8,17-18H2,1-3H3/p+1 |
| InChIKey | GOCVFOVPFRRWCF-UHFFFAOYSA-O |
| XLogP | 5.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|