C27H34ClN2O+ — CID 118928966
[4-[(7-chloro-5-methyl-3,4-dihydronaphthalene-2-carbonyl)amino]phenyl]methyl-cyclohexyl-dimethylazanium (PubChem CID 118928966) has the molecular formula C27H34ClN2O+ and a molecular weight of 438.04 g/mol. Its IUPAC name is [4-[(7-chloro-5-methyl-3,4-dihydronaphthalene-2-carbonyl)amino]phenyl]methyl-cyclohexyl-dimethylazanium.
| Compound Name | [4-[(7-chloro-5-methyl-3,4-dihydronaphthalene-2-carbonyl)amino]phenyl]methyl-cyclohexyl-dimethylazanium |
|---|---|
| PubChem CID | 118928966 |
| Molecular Formula | C27H34ClN2O+ |
| Molecular Weight | 438.04 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | [4-[(7-chloro-5-methyl-3,4-dihydronaphthalene-2-carbonyl)amino]phenyl]methyl-cyclohexyl-dimethylazanium |
| SMILES | Cc1cc(Cl)cc2c1CCC(C(=O)Nc1ccc(C[N+](C)(C)C3CCCCC3)cc1)=C2 |
| InChI | InChI=1S/C27H33ClN2O/c1-19-15-23(28)17-22-16-21(11-14-26(19)22)27(31)29-24-12-9-20(10-13-24)18-30(2,3)25-7-5-4-6-8-25/h9-10,12-13,15-17,25H,4-8,11,14,18H2,1-3H3/p+1 |
| InChIKey | XQDSXIUQMRYISP-UHFFFAOYSA-O |
| XLogP | 6.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.04 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|