C24H28Cl2N2O2S — CID 87453962
[4-[(6-chloro-8-methyl-2H-chromene-3-carbonyl)amino]phenyl]methyl-dimethyl-(thiolan-3-yl)azanium chloride (PubChem CID 87453962) has the molecular formula C24H28Cl2N2O2S and a molecular weight of 479.47 g/mol. Its IUPAC name is [4-[(6-chloro-8-methyl-2H-chromene-3-carbonyl)amino]phenyl]methyl-dimethyl-(thiolan-3-yl)azanium chloride.
| Compound Name | [4-[(6-chloro-8-methyl-2H-chromene-3-carbonyl)amino]phenyl]methyl-dimethyl-(thiolan-3-yl)azanium chloride |
|---|---|
| PubChem CID | 87453962 |
| Molecular Formula | C24H28Cl2N2O2S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | [4-[(6-chloro-8-methyl-2H-chromene-3-carbonyl)amino]phenyl]methyl-dimethyl-(thiolan-3-yl)azanium chloride |
| SMILES | Cc1cc(Cl)cc2c1OCC(C(=O)Nc1ccc(C[N+](C)(C)C3CCSC3)cc1)=C2.[Cl-] |
| InChI | InChI=1S/C24H27ClN2O2S.ClH/c1-16-10-20(25)12-18-11-19(14-29-23(16)18)24(28)26-21-6-4-17(5-7-21)13-27(2,3)22-8-9-30-15-22;/h4-7,10-12,22H,8-9,13-15H2,1-3H3;1H |
| InChIKey | LOHVRIYYXQJKTD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|