C24H26F3N2O2S+ — CID 58775923
dimethyl-(thiolan-3-yl)-[[4-[[6-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]phenyl]methyl]azanium (PubChem CID 58775923) has the molecular formula C24H26F3N2O2S+ and a molecular weight of 463.55 g/mol. Its IUPAC name is dimethyl-(thiolan-3-yl)-[[4-[[6-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]phenyl]methyl]azanium.
| Compound Name | dimethyl-(thiolan-3-yl)-[[4-[[6-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 58775923 |
| Molecular Formula | C24H26F3N2O2S+ |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | dimethyl-(thiolan-3-yl)-[[4-[[6-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]phenyl]methyl]azanium |
| SMILES | C[N+](C)(Cc1ccc(NC(=O)C2=Cc3cc(C(F)(F)F)ccc3OC2)cc1)C1CCSC1 |
| InChI | InChI=1S/C24H25F3N2O2S/c1-29(2,21-9-10-32-15-21)13-16-3-6-20(7-4-16)28-23(30)18-11-17-12-19(24(25,26)27)5-8-22(17)31-14-18/h3-8,11-12,21H,9-10,13-15H2,1-2H3/p+1 |
| InChIKey | SJLQGLLMNKKVHF-UHFFFAOYSA-O |
| XLogP | 5.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|