C25H29Cl2IN2O2 — CID 118914110
cyclohexyl-[[4-[(7,8-dichloro-2H-chromene-3-carbonyl)amino]phenyl]methyl]-dimethylazanium iodide (PubChem CID 118914110) has the molecular formula C25H29Cl2IN2O2 and a molecular weight of 587.33 g/mol. Its IUPAC name is cyclohexyl-[[4-[(7,8-dichloro-2H-chromene-3-carbonyl)amino]phenyl]methyl]-dimethylazanium iodide.
| Compound Name | cyclohexyl-[[4-[(7,8-dichloro-2H-chromene-3-carbonyl)amino]phenyl]methyl]-dimethylazanium iodide |
|---|---|
| PubChem CID | 118914110 |
| Molecular Formula | C25H29Cl2IN2O2 |
| Molecular Weight | 587.33 g/mol |
| Exact Mass | 586.07 |
| IUPAC Name | cyclohexyl-[[4-[(7,8-dichloro-2H-chromene-3-carbonyl)amino]phenyl]methyl]-dimethylazanium iodide |
| SMILES | C[N+](C)(Cc1ccc(NC(=O)C2=Cc3ccc(Cl)c(Cl)c3OC2)cc1)C1CCCCC1.[I-] |
| InChI | InChI=1S/C25H28Cl2N2O2.HI/c1-29(2,21-6-4-3-5-7-21)15-17-8-11-20(12-9-17)28-25(30)19-14-18-10-13-22(26)23(27)24(18)31-16-19;/h8-14,21H,3-7,15-16H2,1-2H3;1H |
| InChIKey | OKWYAHQHDRCEEV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|