C26H32N2O2 — CID 11632800
N-[4-[[cyclohexyl(dimethyl)azaniumyl]methyl]phenyl]-7-methyl-2H-chromene-3-carboximidate (PubChem CID 11632800) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is N-[4-[[cyclohexyl(dimethyl)azaniumyl]methyl]phenyl]-7-methyl-2H-chromene-3-carboximidate.
| Compound Name | N-[4-[[cyclohexyl(dimethyl)azaniumyl]methyl]phenyl]-7-methyl-2H-chromene-3-carboximidate |
|---|---|
| PubChem CID | 11632800 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | N-[4-[[cyclohexyl(dimethyl)azaniumyl]methyl]phenyl]-7-methyl-2H-chromene-3-carboximidate |
| SMILES | Cc1ccc2c(c1)OCC(/C([O-])=N/c1ccc(C[N+](C)(C)C3CCCCC3)cc1)=C2 |
| InChI | InChI=1S/C26H32N2O2/c1-19-9-12-21-16-22(18-30-25(21)15-19)26(29)27-23-13-10-20(11-14-23)17-28(2,3)24-7-5-4-6-8-24/h9-16,24H,4-8,17-18H2,1-3H3 |
| InChIKey | GEXOPIRPGRQTSI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 44.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|