C27H35ClN2O2 — CID 25265996
[4-[(8,9-dihydro-7H-benzo[7]annulene-6-carbonylamino)methyl]phenyl]methyl-dimethyl-(oxan-4-yl)azanium chloride (PubChem CID 25265996) has the molecular formula C27H35ClN2O2 and a molecular weight of 455.04 g/mol. Its IUPAC name is [4-[(8,9-dihydro-7H-benzo[7]annulene-6-carbonylamino)methyl]phenyl]methyl-dimethyl-(oxan-4-yl)azanium chloride.
| Compound Name | [4-[(8,9-dihydro-7H-benzo[7]annulene-6-carbonylamino)methyl]phenyl]methyl-dimethyl-(oxan-4-yl)azanium chloride |
|---|---|
| PubChem CID | 25265996 |
| Molecular Formula | C27H35ClN2O2 |
| Molecular Weight | 455.04 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | [4-[(8,9-dihydro-7H-benzo[7]annulene-6-carbonylamino)methyl]phenyl]methyl-dimethyl-(oxan-4-yl)azanium chloride |
| SMILES | C[N+](C)(Cc1ccc(CNC(=O)C2=Cc3ccccc3CCC2)cc1)C1CCOCC1.[Cl-] |
| InChI | InChI=1S/C27H34N2O2.ClH/c1-29(2,26-14-16-31-17-15-26)20-22-12-10-21(11-13-22)19-28-27(30)25-9-5-8-23-6-3-4-7-24(23)18-25;/h3-4,6-7,10-13,18,26H,5,8-9,14-17,19-20H2,1-2H3;1H |
| InChIKey | VBIXDIMGSJCBFQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.04 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|