C24H27NO3 — CID 91451229
N-[4-(cyclohexylmethyl)phenyl]-7-methoxy-2H-chromene-3-carboxamide (PubChem CID 91451229) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is N-[4-(cyclohexylmethyl)phenyl]-7-methoxy-2H-chromene-3-carboxamide.
| Compound Name | N-[4-(cyclohexylmethyl)phenyl]-7-methoxy-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 91451229 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | N-[4-(cyclohexylmethyl)phenyl]-7-methoxy-2H-chromene-3-carboxamide |
| SMILES | COc1ccc2c(c1)OCC(C(=O)Nc1ccc(CC3CCCCC3)cc1)=C2 |
| InChI | InChI=1S/C24H27NO3/c1-27-22-12-9-19-14-20(16-28-23(19)15-22)24(26)25-21-10-7-18(8-11-21)13-17-5-3-2-4-6-17/h7-12,14-15,17H,2-6,13,16H2,1H3,(H,25,26) |
| InChIKey | IVPXUFWAHPNFJJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |