C23H27Cl2N2O+ — CID 11633080
2-bicyclo[2.2.1]heptanyl-[[4-[(3,4-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium (PubChem CID 11633080) has the molecular formula C23H27Cl2N2O+ and a molecular weight of 418.39 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl-[[4-[(3,4-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium.
| Compound Name | 2-bicyclo[2.2.1]heptanyl-[[4-[(3,4-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium |
|---|---|
| PubChem CID | 11633080 |
| Molecular Formula | C23H27Cl2N2O+ |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl-[[4-[(3,4-dichlorobenzoyl)amino]phenyl]methyl]-dimethylazanium |
| SMILES | C[N+](C)(Cc1ccc(NC(=O)c2ccc(Cl)c(Cl)c2)cc1)C1CC2CCC1C2 |
| InChI | InChI=1S/C23H26Cl2N2O/c1-27(2,22-12-16-3-6-17(22)11-16)14-15-4-8-19(9-5-15)26-23(28)18-7-10-20(24)21(25)13-18/h4-5,7-10,13,16-17,22H,3,6,11-12,14H2,1-2H3/p+1 |
| InChIKey | USMUDLPXXBPJQV-UHFFFAOYSA-O |
| XLogP | 6.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|