C20H17Cl2N3O2 — CID 126490111
3,4-dichloro-N-[4-[[5-methyl-4-(2-oxoethyl)pyrazol-1-yl]methyl]phenyl]benzamide (PubChem CID 126490111) has the molecular formula C20H17Cl2N3O2 and a molecular weight of 402.28 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-[[5-methyl-4-(2-oxoethyl)pyrazol-1-yl]methyl]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[4-[[5-methyl-4-(2-oxoethyl)pyrazol-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 126490111 |
| Molecular Formula | C20H17Cl2N3O2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 3,4-dichloro-N-[4-[[5-methyl-4-(2-oxoethyl)pyrazol-1-yl]methyl]phenyl]benzamide |
| SMILES | Cc1c(CC=O)cnn1Cc1ccc(NC(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H17Cl2N3O2/c1-13-16(8-9-26)11-23-25(13)12-14-2-5-17(6-3-14)24-20(27)15-4-7-18(21)19(22)10-15/h2-7,9-11H,8,12H2,1H3,(H,24,27) |
| InChIKey | XEBRFNLDMICXBK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|