C21H24BrNO2 — CID 91234174
3-bromo-N-[4-[(5,6-dimethyloxan-3-yl)methyl]phenyl]benzamide (PubChem CID 91234174) has the molecular formula C21H24BrNO2 and a molecular weight of 402.33 g/mol. Its IUPAC name is 3-bromo-N-[4-[(5,6-dimethyloxan-3-yl)methyl]phenyl]benzamide.
| Compound Name | 3-bromo-N-[4-[(5,6-dimethyloxan-3-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 91234174 |
| Molecular Formula | C21H24BrNO2 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 3-bromo-N-[4-[(5,6-dimethyloxan-3-yl)methyl]phenyl]benzamide |
| SMILES | CC1CC(Cc2ccc(NC(=O)c3cccc(Br)c3)cc2)COC1C |
| InChI | InChI=1S/C21H24BrNO2/c1-14-10-17(13-25-15(14)2)11-16-6-8-20(9-7-16)23-21(24)18-4-3-5-19(22)12-18/h3-9,12,14-15,17H,10-11,13H2,1-2H3,(H,23,24) |
| InChIKey | IRZOWBNRXNBRIJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |