C9H17ClO — CID 131010757
(2R,4S,6S)-4-chloro-2-methyl-6-propyloxane (PubChem CID 131010757) has the molecular formula C9H17ClO and a molecular weight of 176.69 g/mol. Its IUPAC name is (2R,4S,6S)-4-chloro-2-methyl-6-propyloxane.
| Compound Name | (2R,4S,6S)-4-chloro-2-methyl-6-propyloxane |
|---|---|
| PubChem CID | 131010757 |
| Molecular Formula | C9H17ClO |
| Molecular Weight | 176.69 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (2R,4S,6S)-4-chloro-2-methyl-6-propyloxane |
| SMILES | CCC[C@H]1C[C@@H](Cl)C[C@@H](C)O1 |
| InChI | InChI=1S/C9H17ClO/c1-3-4-9-6-8(10)5-7(2)11-9/h7-9H,3-6H2,1-2H3/t7-,8+,9+/m1/s1 |
| InChIKey | DVKDQBQLULUIKW-VGMNWLOBSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.69 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|