C12H23ClO — CID 15865907
(2S,4S,6R)-4-chloro-2-hexyl-6-methyloxane (PubChem CID 15865907) has the molecular formula C12H23ClO and a molecular weight of 218.77 g/mol. Its IUPAC name is (2S,4S,6R)-4-chloro-2-hexyl-6-methyloxane.
| Compound Name | (2S,4S,6R)-4-chloro-2-hexyl-6-methyloxane |
|---|---|
| PubChem CID | 15865907 |
| Molecular Formula | C12H23ClO |
| Molecular Weight | 218.77 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (2S,4S,6R)-4-chloro-2-hexyl-6-methyloxane |
| SMILES | CCCCCC[C@H]1C[C@@H](Cl)C[C@@H](C)O1 |
| InChI | InChI=1S/C12H23ClO/c1-3-4-5-6-7-12-9-11(13)8-10(2)14-12/h10-12H,3-9H2,1-2H3/t10-,11+,12+/m1/s1 |
| InChIKey | PCGPJYCXUHHFAI-WOPDTQHZSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.77 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|