C11H22O3 — CID 10397949
(2S,4R,6S)-6-hexyl-2-methyl-1,3-dioxan-4-ol (PubChem CID 10397949) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is (2S,4R,6S)-6-hexyl-2-methyl-1,3-dioxan-4-ol.
| Compound Name | (2S,4R,6S)-6-hexyl-2-methyl-1,3-dioxan-4-ol |
|---|---|
| PubChem CID | 10397949 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | (2S,4R,6S)-6-hexyl-2-methyl-1,3-dioxan-4-ol |
| SMILES | CCCCCC[C@H]1C[C@H](O)O[C@@H](C)O1 |
| InChI | InChI=1S/C11H22O3/c1-3-4-5-6-7-10-8-11(12)14-9(2)13-10/h9-12H,3-8H2,1-2H3/t9-,10-,11+/m0/s1 |
| InChIKey | BBEFOZPVNFBRPK-GARJFASQSA-N |
| XLogP | 2.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|