C15H27IO2 — CID 155451124
(2S,6R)-2-[2-[(2R,4S,6S)-4,6-dimethyloxan-2-yl]ethyl]-4-iodo-6-methyloxane (PubChem CID 155451124) has the molecular formula C15H27IO2 and a molecular weight of 366.28 g/mol. Its IUPAC name is (2S,6R)-2-[2-[(2R,4S,6S)-4,6-dimethyloxan-2-yl]ethyl]-4-iodo-6-methyloxane.
| Compound Name | (2S,6R)-2-[2-[(2R,4S,6S)-4,6-dimethyloxan-2-yl]ethyl]-4-iodo-6-methyloxane |
|---|---|
| PubChem CID | 155451124 |
| Molecular Formula | C15H27IO2 |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (2S,6R)-2-[2-[(2R,4S,6S)-4,6-dimethyloxan-2-yl]ethyl]-4-iodo-6-methyloxane |
| SMILES | C[C@@H]1C[C@@H](CC[C@H]2CC(I)C[C@@H](C)O2)O[C@@H](C)C1 |
| InChI | InChI=1S/C15H27IO2/c1-10-6-11(2)17-14(7-10)4-5-15-9-13(16)8-12(3)18-15/h10-15H,4-9H2,1-3H3/t10-,11-,12+,13?,14+,15-/m0/s1 |
| InChIKey | NXSUWYNFHSPKEE-WRQLNJJISA-N |
| XLogP | 4.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|