C15H24O5 — CID 11471632
(1'S,2'S,5'S)-1'-[2-(methoxymethoxy)ethyl]-2'-methylspiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]octane]-6'-one (PubChem CID 11471632) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (1'S,2'S,5'S)-1'-[2-(methoxymethoxy)ethyl]-2'-methylspiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]octane]-6'-one.
| Compound Name | (1'S,2'S,5'S)-1'-[2-(methoxymethoxy)ethyl]-2'-methylspiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]octane]-6'-one |
|---|---|
| PubChem CID | 11471632 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (1'S,2'S,5'S)-1'-[2-(methoxymethoxy)ethyl]-2'-methylspiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]octane]-6'-one |
| SMILES | COCOCC[C@]12CC(=O)[C@H](C1)C1(C[C@@H]2C)OCCO1 |
| InChI | InChI=1S/C15H24O5/c1-11-7-15(19-5-6-20-15)12-8-14(11,9-13(12)16)3-4-18-10-17-2/h11-12H,3-10H2,1-2H3/t11-,12-,14+/m0/s1 |
| InChIKey | DPGIQMYMBQSZQU-SGMGOOAPSA-N |
| XLogP | 1.75 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|