C19H30O5 — CID 10914718
(1'S,2'R,5'S,6'S,7'S)-6'-[2-(methoxymethoxy)ethyl]-5'-methylspiro[1,3-dioxolane-2,3'-11-oxatetracyclo[5.3.2.12,6.01,7]tridecane] (PubChem CID 10914718) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is (1'S,2'R,5'S,6'S,7'S)-6'-[2-(methoxymethoxy)ethyl]-5'-methylspiro[1,3-dioxolane-2,3'-11-oxatetracyclo[5.3.2.12,6.01,7]tridecane].
| Compound Name | (1'S,2'R,5'S,6'S,7'S)-6'-[2-(methoxymethoxy)ethyl]-5'-methylspiro[1,3-dioxolane-2,3'-11-oxatetracyclo[5.3.2.12,6.01,7]tridecane] |
|---|---|
| PubChem CID | 10914718 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (1'S,2'R,5'S,6'S,7'S)-6'-[2-(methoxymethoxy)ethyl]-5'-methylspiro[1,3-dioxolane-2,3'-11-oxatetracyclo[5.3.2.12,6.01,7]tridecane] |
| SMILES | COCOCC[C@@]12C[C@@H](C3(C[C@@H]1C)OCCO3)[C@@]13CCC[C@@]21CO3 |
| InChI | InChI=1S/C19H30O5/c1-14-10-19(22-8-9-23-19)15-11-16(14,6-7-21-13-20-2)17-4-3-5-18(15,17)24-12-17/h14-15H,3-13H2,1-2H3/t14-,15+,16+,17+,18-/m0/s1 |
| InChIKey | FWKLWZXWDLUXNT-TZNCUMHOSA-N |
| XLogP | 2.73 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|