C16H26O4 — CID 11033330
8-(1-cyclopropylideneethyl)-8-(methoxymethoxymethyl)-1,4-dioxaspiro[4.5]decane (PubChem CID 11033330) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 8-(1-cyclopropylideneethyl)-8-(methoxymethoxymethyl)-1,4-dioxaspiro[4.5]decane.
| Compound Name | 8-(1-cyclopropylideneethyl)-8-(methoxymethoxymethyl)-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 11033330 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 8-(1-cyclopropylideneethyl)-8-(methoxymethoxymethyl)-1,4-dioxaspiro[4.5]decane |
| SMILES | COCOCC1(C(C)=C2CC2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C16H26O4/c1-13(14-3-4-14)15(11-18-12-17-2)5-7-16(8-6-15)19-9-10-20-16/h3-12H2,1-2H3 |
| InChIKey | WTGRJCFNAYGNAA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|