C24H40O6 — CID 101225993
(3'R,4'S,8'S)-8'-(methoxymethoxymethyl)-3',4',8'-trimethyl-4'-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]spiro[1,3-dioxolane-2,6'-2,3,5,7-tetrahydro-1H-naphthalene] (PubChem CID 101225993) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is (3'R,4'S,8'S)-8'-(methoxymethoxymethyl)-3',4',8'-trimethyl-4'-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]spiro[1,3-dioxolane-2,6'-2,3,5,7-tetrahydro-1H-naphthalene].
| Compound Name | (3'R,4'S,8'S)-8'-(methoxymethoxymethyl)-3',4',8'-trimethyl-4'-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]spiro[1,3-dioxolane-2,6'-2,3,5,7-tetrahydro-1H-naphthalene] |
|---|---|
| PubChem CID | 101225993 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | (3'R,4'S,8'S)-8'-(methoxymethoxymethyl)-3',4',8'-trimethyl-4'-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]spiro[1,3-dioxolane-2,6'-2,3,5,7-tetrahydro-1H-naphthalene] |
| SMILES | COCOC[C@@]1(C)CC2(CC3=C1CC[C@@H](C)[C@]3(C)CCC1(C)OCCO1)OCCO2 |
| InChI | InChI=1S/C24H40O6/c1-18-6-7-19-20(22(18,3)8-9-23(4)27-10-11-28-23)14-24(29-12-13-30-24)15-21(19,2)16-26-17-25-5/h18H,6-17H2,1-5H3/t18-,21-,22+/m1/s1 |
| InChIKey | MDKWDHWWQKPIFY-QIJUGHKUSA-N |
| XLogP | 4.43 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|