C16H30O3Si — CID 74955942
trimethyl-[4-methyl-3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]cyclohexen-1-yl]oxysilane (PubChem CID 74955942) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is trimethyl-[4-methyl-3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]cyclohexen-1-yl]oxysilane.
| Compound Name | trimethyl-[4-methyl-3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]cyclohexen-1-yl]oxysilane |
|---|---|
| PubChem CID | 74955942 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | trimethyl-[4-methyl-3-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]cyclohexen-1-yl]oxysilane |
| SMILES | CC1CCC(O[Si](C)(C)C)=CC1CCC1(C)OCCO1 |
| InChI | InChI=1S/C16H30O3Si/c1-13-6-7-15(19-20(3,4)5)12-14(13)8-9-16(2)17-10-11-18-16/h12-14H,6-11H2,1-5H3 |
| InChIKey | YQNZQLJRUCGCSP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|