C15H30O2Si2 — CID 102257492
[(3S,4R)-3,4-dimethyl-6-trimethylsilyloxycyclohepta-1,5-dien-1-yl]oxy-trimethylsilane (PubChem CID 102257492) has the molecular formula C15H30O2Si2 and a molecular weight of 298.57 g/mol. Its IUPAC name is [(3S,4R)-3,4-dimethyl-6-trimethylsilyloxycyclohepta-1,5-dien-1-yl]oxy-trimethylsilane.
| Compound Name | [(3S,4R)-3,4-dimethyl-6-trimethylsilyloxycyclohepta-1,5-dien-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 102257492 |
| Molecular Formula | C15H30O2Si2 |
| Molecular Weight | 298.57 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [(3S,4R)-3,4-dimethyl-6-trimethylsilyloxycyclohepta-1,5-dien-1-yl]oxy-trimethylsilane |
| SMILES | C[C@@H]1C=C(O[Si](C)(C)C)CC(O[Si](C)(C)C)=C[C@@H]1C |
| InChI | InChI=1S/C15H30O2Si2/c1-12-9-14(16-18(3,4)5)11-15(10-13(12)2)17-19(6,7)8/h9-10,12-13H,11H2,1-8H3/t12-,13+ |
| InChIKey | MGHPJIVFXZNQRD-BETUJISGSA-N |
| XLogP | 5.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|