C12H21NO2Si — CID 11207183
2-methoxy-1-methyl-4-trimethylsilyloxycyclohex-3-ene-1-carbonitrile (PubChem CID 11207183) has the molecular formula C12H21NO2Si and a molecular weight of 239.39 g/mol. Its IUPAC name is 2-methoxy-1-methyl-4-trimethylsilyloxycyclohex-3-ene-1-carbonitrile.
| Compound Name | 2-methoxy-1-methyl-4-trimethylsilyloxycyclohex-3-ene-1-carbonitrile |
|---|---|
| PubChem CID | 11207183 |
| Molecular Formula | C12H21NO2Si |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-methoxy-1-methyl-4-trimethylsilyloxycyclohex-3-ene-1-carbonitrile |
| SMILES | COC1C=C(O[Si](C)(C)C)CCC1(C)C#N |
| InChI | InChI=1S/C12H21NO2Si/c1-12(9-13)7-6-10(8-11(12)14-2)15-16(3,4)5/h8,11H,6-7H2,1-5H3 |
| InChIKey | BJQRJHOCZQJWFS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|