C13H14N4OSi — CID 134992421
4-trimethylsilyloxycyclohex-4-ene-1,1,2,2-tetracarbonitrile (PubChem CID 134992421) has the molecular formula C13H14N4OSi and a molecular weight of 270.37 g/mol. Its IUPAC name is 4-trimethylsilyloxycyclohex-4-ene-1,1,2,2-tetracarbonitrile.
| Compound Name | 4-trimethylsilyloxycyclohex-4-ene-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 134992421 |
| Molecular Formula | C13H14N4OSi |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-trimethylsilyloxycyclohex-4-ene-1,1,2,2-tetracarbonitrile |
| SMILES | C[Si](C)(C)OC1=CCC(C#N)(C#N)C(C#N)(C#N)C1 |
| InChI | InChI=1S/C13H14N4OSi/c1-19(2,3)18-11-4-5-12(7-14,8-15)13(6-11,9-16)10-17/h4H,5-6H2,1-3H3 |
| InChIKey | URCAYRCOQVKPBZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 104.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|