C29H18N4 — CID 155929360
spiro[1,3,5,8-tetrahydrocyclopenta[g]naphthalene-2,9'-fluorene]-6,6,7,7-tetracarbonitrile (PubChem CID 155929360) has the molecular formula C29H18N4 and a molecular weight of 422.49 g/mol. Its IUPAC name is spiro[1,3,5,8-tetrahydrocyclopenta[g]naphthalene-2,9'-fluorene]-6,6,7,7-tetracarbonitrile.
| Compound Name | spiro[1,3,5,8-tetrahydrocyclopenta[g]naphthalene-2,9'-fluorene]-6,6,7,7-tetracarbonitrile |
|---|---|
| PubChem CID | 155929360 |
| Molecular Formula | C29H18N4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | spiro[1,3,5,8-tetrahydrocyclopenta[g]naphthalene-2,9'-fluorene]-6,6,7,7-tetracarbonitrile |
| SMILES | N#CC1(C#N)Cc2cc3c(cc2CC1(C#N)C#N)CC1(C3)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H18N4/c30-15-27(16-31)11-19-9-21-13-29(14-22(21)10-20(19)12-28(27,17-32)18-33)25-7-3-1-5-23(25)24-6-2-4-8-26(24)29/h1-10H,11-14H2 |
| InChIKey | YFTPWWHVIXVFBD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|