C18H15N — CID 23151763
spiro[cyclopentane-1,9'-fluorene]-1'-carbonitrile (PubChem CID 23151763) has the molecular formula C18H15N and a molecular weight of 245.33 g/mol. Its IUPAC name is spiro[cyclopentane-1,9'-fluorene]-1'-carbonitrile.
| Compound Name | spiro[cyclopentane-1,9'-fluorene]-1'-carbonitrile |
|---|---|
| PubChem CID | 23151763 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | spiro[cyclopentane-1,9'-fluorene]-1'-carbonitrile |
| SMILES | N#Cc1cccc2c1C1(CCCC1)c1ccccc1-2 |
| InChI | InChI=1S/C18H15N/c19-12-13-6-5-8-15-14-7-1-2-9-16(14)18(17(13)15)10-3-4-11-18/h1-2,5-9H,3-4,10-11H2 |
| InChIKey | MXBFMVIPRDCOTI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |