About 1'-iodospiro[cyclohexane-1,9'-fluorene]
1'-iodospiro[cyclohexane-1,9'-fluorene] (PubChem CID 142567554) has the molecular formula C18H17I
and a molecular weight of 360.24 g/mol. Its IUPAC name is 1'-iodospiro[cyclohexane-1,9'-fluorene].
Molecular Properties
| Compound Name | 1'-iodospiro[cyclohexane-1,9'-fluorene] |
| PubChem CID | 142567554 |
| Molecular Formula | C18H17I |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 1'-iodospiro[cyclohexane-1,9'-fluorene] |
| SMILES | Ic1cccc2c1C1(CCCCC1)c1ccccc1-2 |
| InChI | InChI=1S/C18H17I/c19-16-10-6-8-14-13-7-2-3-9-15(13)18(17(14)16)11-4-1-5-12-18/h2-3,6-10H,1,4-5,11-12H2 |
| InChIKey | OQSVTKDJJXXRET-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1'-iodospiro[cyclohexane-1,9'-fluorene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-iodospiro[cyclohexane-1,9'-fluorene]?
The IUPAC name of 1'-iodospiro[cyclohexane-1,9'-fluorene] (CID 142567554) is 1'-iodospiro[cyclohexane-1,9'-fluorene].
What is the SMILES notation for 1'-iodospiro[cyclohexane-1,9'-fluorene]?
The canonical SMILES for 1'-iodospiro[cyclohexane-1,9'-fluorene] is Ic1cccc2c1C1(CCCCC1)c1ccccc1-2.
What is the InChIKey of 1'-iodospiro[cyclohexane-1,9'-fluorene]?
The InChIKey is OQSVTKDJJXXRET-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17I/c19-16-10-6-8-14-13-7-2-3-9-15(13)18(17(14)16)11-4-1-5-12-18/h2-3,6-10H,1,4-5,11-12H2.
What are the key properties of 1'-iodospiro[cyclohexane-1,9'-fluorene]?
1'-iodospiro[cyclohexane-1,9'-fluorene] has a molecular weight of 360.24 g/mol, XLogP of 5.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-iodospiro[cyclohexane-1,9'-fluorene] is sourced from PubChem (CID 142567554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).