C21H30 — CID 144945934
methane;1'-methylspiro[cyclopentane-1,9'-fluorene] (PubChem CID 144945934) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is methane;1'-methylspiro[cyclopentane-1,9'-fluorene].
| Compound Name | methane;1'-methylspiro[cyclopentane-1,9'-fluorene] |
|---|---|
| PubChem CID | 144945934 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | methane;1'-methylspiro[cyclopentane-1,9'-fluorene] |
| SMILES | C.C.C.Cc1cccc2c1C1(CCCC1)c1ccccc1-2 |
| InChI | InChI=1S/C18H18.3CH4/c1-13-7-6-9-15-14-8-2-3-10-16(14)18(17(13)15)11-4-5-12-18;;;/h2-3,6-10H,4-5,11-12H2,1H3;3*1H4 |
| InChIKey | RBWOPLRUQGEYDY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |