About 4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine]
4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine] (PubChem CID 164528258) has the molecular formula C18H18ClN
and a molecular weight of 283.80 g/mol. Its IUPAC name is 4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine].
Molecular Properties
| Compound Name | 4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine] |
| PubChem CID | 164528258 |
| Molecular Formula | C18H18ClN |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine] |
| SMILES | Cc1cnc2c(c1Cl)C1(CCCCC1)c1ccccc1-2 |
| InChI | InChI=1S/C18H18ClN/c1-12-11-20-17-13-7-3-4-8-14(13)18(15(17)16(12)19)9-5-2-6-10-18/h3-4,7-8,11H,2,5-6,9-10H2,1H3 |
| InChIKey | MAJKFPIYRLPZGX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine]?
The IUPAC name of 4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine] (CID 164528258) is 4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine].
What is the SMILES notation for 4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine]?
The canonical SMILES for 4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine] is Cc1cnc2c(c1Cl)C1(CCCCC1)c1ccccc1-2.
What is the InChIKey of 4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine]?
The InChIKey is MAJKFPIYRLPZGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClN/c1-12-11-20-17-13-7-3-4-8-14(13)18(15(17)16(12)19)9-5-2-6-10-18/h3-4,7-8,11H,2,5-6,9-10H2,1H3.
What are the key properties of 4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine]?
4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine] has a molecular weight of 283.80 g/mol, XLogP of 5.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-chloro-3'-methylspiro[cyclohexane-1,5'-indeno[1,2-b]pyridine] is sourced from PubChem (CID 164528258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).