C15H24O5Si — CID 25208498
dimethyl (3R)-6-trimethylsilyloxyspiro[2.5]oct-6-ene-2,2-dicarboxylate (PubChem CID 25208498) has the molecular formula C15H24O5Si and a molecular weight of 312.44 g/mol. Its IUPAC name is dimethyl (3R)-6-trimethylsilyloxyspiro[2.5]oct-6-ene-2,2-dicarboxylate.
| Compound Name | dimethyl (3R)-6-trimethylsilyloxyspiro[2.5]oct-6-ene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 25208498 |
| Molecular Formula | C15H24O5Si |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | dimethyl (3R)-6-trimethylsilyloxyspiro[2.5]oct-6-ene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@]12CC=C(O[Si](C)(C)C)CC2 |
| InChI | InChI=1S/C15H24O5Si/c1-18-12(16)15(13(17)19-2)10-14(15)8-6-11(7-9-14)20-21(3,4)5/h6H,7-10H2,1-5H3/t14-/m0/s1 |
| InChIKey | NAVUPURAJSFTJG-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|