C18H30O7Si — CID 134979345
2-O-ethyl 1-O-methyl 1-O'-propan-2-yl (1R,2S)-4-trimethylsilyloxycyclohex-4-ene-1,1,2-tricarboxylate (PubChem CID 134979345) has the molecular formula C18H30O7Si and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-O-ethyl 1-O-methyl 1-O'-propan-2-yl (1R,2S)-4-trimethylsilyloxycyclohex-4-ene-1,1,2-tricarboxylate.
| Compound Name | 2-O-ethyl 1-O-methyl 1-O'-propan-2-yl (1R,2S)-4-trimethylsilyloxycyclohex-4-ene-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 134979345 |
| Molecular Formula | C18H30O7Si |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-O-ethyl 1-O-methyl 1-O'-propan-2-yl (1R,2S)-4-trimethylsilyloxycyclohex-4-ene-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)[C@H]1CC(O[Si](C)(C)C)=CC[C@@]1(C(=O)OC)C(=O)OC(C)C |
| InChI | InChI=1S/C18H30O7Si/c1-8-23-15(19)14-11-13(25-26(5,6)7)9-10-18(14,16(20)22-4)17(21)24-12(2)3/h9,12,14H,8,10-11H2,1-7H3/t14-,18-/m1/s1 |
| InChIKey | ZYWCYNFTSLEWQU-RDTXWAMCSA-N |
| XLogP | 2.81 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|