C23H33NO4 — CID 16744992
(7'R,8'R,9'S,13'S,14'S,17'S)-17'-(methoxymethoxy)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-7'-carbonitrile (PubChem CID 16744992) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is (7'R,8'R,9'S,13'S,14'S,17'S)-17'-(methoxymethoxy)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-7'-carbonitrile.
| Compound Name | (7'R,8'R,9'S,13'S,14'S,17'S)-17'-(methoxymethoxy)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-7'-carbonitrile |
|---|---|
| PubChem CID | 16744992 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | (7'R,8'R,9'S,13'S,14'S,17'S)-17'-(methoxymethoxy)-13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene]-7'-carbonitrile |
| SMILES | COCO[C@H]1CC[C@H]2[C@@H]3[C@H](C#N)CC4=C(CCC5(C4)OCCO5)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H33NO4/c1-22-7-5-18-17-6-8-23(27-9-10-28-23)12-15(17)11-16(13-24)21(18)19(22)3-4-20(22)26-14-25-2/h16,18-21H,3-12,14H2,1-2H3/t16-,18+,19-,20-,21+,22-/m0/s1 |
| InChIKey | RWIFCGVTYSFYTF-NUUSQOIHSA-N |
| XLogP | 4.19 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|