C27H38O6 — CID 137395277
ethyl 2-[(1R,4R,11S,14S,15S,18S)-7,15-bis(methoxymethoxy)-14-methyl-3-pentacyclo[9.7.0.02,4.05,10.014,18]octadeca-5(10),6,8-trienyl]acetate (PubChem CID 137395277) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is ethyl 2-[(1R,4R,11S,14S,15S,18S)-7,15-bis(methoxymethoxy)-14-methyl-3-pentacyclo[9.7.0.02,4.05,10.014,18]octadeca-5(10),6,8-trienyl]acetate.
| Compound Name | ethyl 2-[(1R,4R,11S,14S,15S,18S)-7,15-bis(methoxymethoxy)-14-methyl-3-pentacyclo[9.7.0.02,4.05,10.014,18]octadeca-5(10),6,8-trienyl]acetate |
|---|---|
| PubChem CID | 137395277 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | ethyl 2-[(1R,4R,11S,14S,15S,18S)-7,15-bis(methoxymethoxy)-14-methyl-3-pentacyclo[9.7.0.02,4.05,10.014,18]octadeca-5(10),6,8-trienyl]acetate |
| SMILES | CCOC(=O)CC1C2[C@@H]1c1cc(OCOC)ccc1[C@H]1CC[C@]3(C)[C@@H](OCOC)CC[C@H]3[C@H]21 |
| InChI | InChI=1S/C27H38O6/c1-5-31-23(28)13-20-24-19-12-16(32-14-29-3)6-7-17(19)18-10-11-27(2)21(25(18)26(20)24)8-9-22(27)33-15-30-4/h6-7,12,18,20-22,24-26H,5,8-11,13-15H2,1-4H3/t18-,20?,21+,22+,24-,25-,26?,27+/m1/s1 |
| InChIKey | SQWWQZFZXLBGNP-HPJOZSSMSA-N |
| XLogP | 4.86 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|