C26H32O8 — CID 91741990
[(6S,7S,8R,9S,13S,14S,17S)-3,6,7-triacetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 91741990) has the molecular formula C26H32O8 and a molecular weight of 472.53 g/mol. Its IUPAC name is [(6S,7S,8R,9S,13S,14S,17S)-3,6,7-triacetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(6S,7S,8R,9S,13S,14S,17S)-3,6,7-triacetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 91741990 |
| Molecular Formula | C26H32O8 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | [(6S,7S,8R,9S,13S,14S,17S)-3,6,7-triacetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C26H32O8/c1-13(27)31-17-6-7-18-19-10-11-26(5)21(8-9-22(26)32-14(2)28)23(19)25(34-16(4)30)24(20(18)12-17)33-15(3)29/h6-7,12,19,21-25H,8-11H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+/m1/s1 |
| InChIKey | KQMGYHMNXGVBGW-VFZNMGFGSA-N |
| XLogP | 4.00 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|