C24H29NO4 — CID 10982148
[(7S,8R,9S,13S,14S,17S)-3-acetyloxy-7-(cyanomethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 10982148) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is [(7S,8R,9S,13S,14S,17S)-3-acetyloxy-7-(cyanomethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7S,8R,9S,13S,14S,17S)-3-acetyloxy-7-(cyanomethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 10982148 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | [(7S,8R,9S,13S,14S,17S)-3-acetyloxy-7-(cyanomethyl)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)C[C@@H](CC#N)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C24H29NO4/c1-14(26)28-18-4-5-19-17(13-18)12-16(9-11-25)23-20(19)8-10-24(3)21(23)6-7-22(24)29-15(2)27/h4-5,13,16,20-23H,6-10,12H2,1-3H3/t16-,20-,21+,22+,23-,24+/m1/s1 |
| InChIKey | DKNZMXQDRMKIEY-KTSMFKKLSA-N |
| XLogP | 4.54 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|