C23H30O4 — CID 21135696
[(7R,8R,9S,13S,14S,17S)-2-acetyl-3-hydroxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 21135696) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is [(7R,8R,9S,13S,14S,17S)-2-acetyl-3-hydroxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7R,8R,9S,13S,14S,17S)-2-acetyl-3-hydroxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 21135696 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [(7R,8R,9S,13S,14S,17S)-2-acetyl-3-hydroxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3[C@H](C)Cc4cc(O)c(C(C)=O)cc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H30O4/c1-12-9-15-10-20(26)17(13(2)24)11-18(15)16-7-8-23(4)19(22(12)16)5-6-21(23)27-14(3)25/h10-12,16,19,21-22,26H,5-9H2,1-4H3/t12-,16-,19+,21+,22-,23+/m1/s1 |
| InChIKey | ALWHUODCDILALH-SADFIZPGSA-N |
| XLogP | 4.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |