C28H40O5 — CID 86663330
6-[(6R,8R,9S,13S,14S,17S)-3,17-bis(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-6-yl]hexa-2,4-dien-1-ol (PubChem CID 86663330) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is 6-[(6R,8R,9S,13S,14S,17S)-3,17-bis(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-6-yl]hexa-2,4-dien-1-ol.
| Compound Name | 6-[(6R,8R,9S,13S,14S,17S)-3,17-bis(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-6-yl]hexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 86663330 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 6-[(6R,8R,9S,13S,14S,17S)-3,17-bis(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-6-yl]hexa-2,4-dien-1-ol |
| SMILES | COCOc1ccc2c(c1)[C@H](CC=CC=CCO)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OCOC)CC[C@@H]12 |
| InChI | InChI=1S/C28H40O5/c1-28-14-13-23-22-10-9-21(32-18-30-2)17-24(22)20(8-6-4-5-7-15-29)16-25(23)26(28)11-12-27(28)33-19-31-3/h4-7,9-10,17,20,23,25-27,29H,8,11-16,18-19H2,1-3H3/t20-,23-,25-,26+,27+,28+/m1/s1 |
| InChIKey | PMILCUWMEAARMK-KYUGRZKOSA-N |
| XLogP | 5.55 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|