C22H31NO3 — CID 70935114
[(6R,8R,9R,13S,14R)-6-(aminooxymethyl)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 70935114) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is [(6R,8R,9R,13S,14R)-6-(aminooxymethyl)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(6R,8R,9R,13S,14R)-6-(aminooxymethyl)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 70935114 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | [(6R,8R,9R,13S,14R)-6-(aminooxymethyl)-3,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)OC1CC[C@@H]2[C@@H]3C[C@@H](CON)c4cc(C)ccc4[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C22H31NO3/c1-13-4-5-16-17-8-9-22(3)20(6-7-21(22)26-14(2)24)19(17)11-15(12-25-23)18(16)10-13/h4-5,10,15,17,19-21H,6-9,11-12,23H2,1-3H3/t15-,17-,19+,20+,21?,22-/m0/s1 |
| InChIKey | OUJJBKOKWXUPPN-CQOOSHHTSA-N |
| XLogP | 4.21 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|