C22H34O — CID 143686608
ethane;(6S,13S,17S)-3,6,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 143686608) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is ethane;(6S,13S,17S)-3,6,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | ethane;(6S,13S,17S)-3,6,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 143686608 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | ethane;(6S,13S,17S)-3,6,13-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CC.Cc1ccc2c(c1)[C@@H](C)CC1C2CC[C@@]2(C)C1CC[C@@H]2O |
| InChI | InChI=1S/C20H28O.C2H6/c1-12-4-5-14-15-8-9-20(3)18(6-7-19(20)21)17(15)11-13(2)16(14)10-12;1-2/h4-5,10,13,15,17-19,21H,6-9,11H2,1-3H3;1-2H3/t13-,15?,17?,18?,19-,20-;/m0./s1 |
| InChIKey | QRXBMYDESXUOGZ-CXWBTGTQSA-N |
| XLogP | 5.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |