C19H29FO — CID 22295881
(3R,6R,8R,9S,13S,14S,17S)-3-fluoro-6,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 22295881) has the molecular formula C19H29FO and a molecular weight of 292.44 g/mol. Its IUPAC name is (3R,6R,8R,9S,13S,14S,17S)-3-fluoro-6,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (3R,6R,8R,9S,13S,14S,17S)-3-fluoro-6,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 22295881 |
| Molecular Formula | C19H29FO |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (3R,6R,8R,9S,13S,14S,17S)-3-fluoro-6,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@@H]1C[C@@H]2[C@H](CC[C@]3(C)[C@@H](O)CC[C@@H]23)C2=C1C[C@H](F)CC2 |
| InChI | InChI=1S/C19H29FO/c1-11-9-16-14(13-4-3-12(20)10-15(11)13)7-8-19(2)17(16)5-6-18(19)21/h11-12,14,16-18,21H,3-10H2,1-2H3/t11-,12-,14-,16-,17+,18+,19+/m1/s1 |
| InChIKey | HCEHOYVTLZIVER-LAPMFEOTSA-N |
| XLogP | 4.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|