C22H28O — CID 145492736
(13S,17S)-4,13-dimethyl-3-prop-1-ynyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 145492736) has the molecular formula C22H28O and a molecular weight of 308.47 g/mol. Its IUPAC name is (13S,17S)-4,13-dimethyl-3-prop-1-ynyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (13S,17S)-4,13-dimethyl-3-prop-1-ynyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 145492736 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | (13S,17S)-4,13-dimethyl-3-prop-1-ynyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CC#Cc1ccc2c(c1C)CCC1C2CC[C@@]2(C)C1CC[C@@H]2O |
| InChI | InChI=1S/C22H28O/c1-4-5-15-6-7-17-16(14(15)2)8-9-19-18(17)12-13-22(3)20(19)10-11-21(22)23/h6-7,18-21,23H,8-13H2,1-3H3/t18?,19?,20?,21-,22-/m0/s1 |
| InChIKey | KPGGCFUJSRDTPD-IOHZUATHSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|