C30H43NO — CID 145492735
(13S,17S)-4,13-dimethyl-3-prop-1-ynyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol;ethane;4-methyl-1,2-dihydropyridine (PubChem CID 145492735) has the molecular formula C30H43NO and a molecular weight of 433.68 g/mol. Its IUPAC name is (13S,17S)-4,13-dimethyl-3-prop-1-ynyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol;ethane;4-methyl-1,2-dihydropyridine.
| Compound Name | (13S,17S)-4,13-dimethyl-3-prop-1-ynyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol;ethane;4-methyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 145492735 |
| Molecular Formula | C30H43NO |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.33 |
| IUPAC Name | (13S,17S)-4,13-dimethyl-3-prop-1-ynyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol;ethane;4-methyl-1,2-dihydropyridine |
| SMILES | CC.CC#Cc1ccc2c(c1C)CCC1C2CC[C@@]2(C)C1CC[C@@H]2O.CC1=CCNC=C1 |
| InChI | InChI=1S/C22H28O.C6H9N.C2H6/c1-4-5-15-6-7-17-16(14(15)2)8-9-19-18(17)12-13-22(3)20(19)10-11-21(22)23;1-6-2-4-7-5-3-6;1-2/h6-7,18-21,23H,8-13H2,1-3H3;2-4,7H,5H2,1H3;1-2H3/t18?,19?,20?,21-,22-;;/m0../s1 |
| InChIKey | DZZVGPHKCSWTDN-LNQFEXIMSA-N |
| XLogP | 6.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|