C28H33FN2 — CID 145492806
(13R,17S)-4-fluoro-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carbonitrile;4-prop-1-ynyl-1,2-dihydropyridine (PubChem CID 145492806) has the molecular formula C28H33FN2 and a molecular weight of 416.58 g/mol. Its IUPAC name is (13R,17S)-4-fluoro-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carbonitrile;4-prop-1-ynyl-1,2-dihydropyridine.
| Compound Name | (13R,17S)-4-fluoro-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carbonitrile;4-prop-1-ynyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 145492806 |
| Molecular Formula | C28H33FN2 |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (13R,17S)-4-fluoro-13,17-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carbonitrile;4-prop-1-ynyl-1,2-dihydropyridine |
| SMILES | CC#CC1=CCNC=C1.C[C@H]1CCC2C3CCc4c(ccc(C#N)c4F)C3CC[C@@]21C |
| InChI | InChI=1S/C20H24FN.C8H9N/c1-12-3-8-18-16-6-7-17-14(5-4-13(11-22)19(17)21)15(16)9-10-20(12,18)2;1-2-3-8-4-6-9-7-5-8/h4-5,12,15-16,18H,3,6-10H2,1-2H3;4-6,9H,7H2,1H3/t12-,15?,16?,18?,20+;/m0./s1 |
| InChIKey | XBZLIIFPEBJSKO-XDDYWECKSA-N |
| XLogP | 6.24 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|