C24H30O — CID 143730690
2-[(13R)-13,17-dimethyl-2-prop-1-ynyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]acetaldehyde (PubChem CID 143730690) has the molecular formula C24H30O and a molecular weight of 334.50 g/mol. Its IUPAC name is 2-[(13R)-13,17-dimethyl-2-prop-1-ynyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]acetaldehyde.
| Compound Name | 2-[(13R)-13,17-dimethyl-2-prop-1-ynyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 143730690 |
| Molecular Formula | C24H30O |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 2-[(13R)-13,17-dimethyl-2-prop-1-ynyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]acetaldehyde |
| SMILES | CC#Cc1cc2c(cc1CC=O)CCC1C2CC[C@]2(C)C(C)CCC12 |
| InChI | InChI=1S/C24H30O/c1-4-5-17-15-22-19(14-18(17)11-13-25)7-8-21-20(22)10-12-24(3)16(2)6-9-23(21)24/h13-16,20-21,23H,6-12H2,1-3H3/t16?,20?,21?,23?,24-/m1/s1 |
| InChIKey | SCPPOVNWHWLGNR-LKXUPXEQSA-N |
| XLogP | 5.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|