C21H28O2 — CID 71098820
(13R)-2,13,17-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid (PubChem CID 71098820) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is (13R)-2,13,17-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid.
| Compound Name | (13R)-2,13,17-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid |
|---|---|
| PubChem CID | 71098820 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (13R)-2,13,17-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid |
| SMILES | Cc1cc2c(cc1C(=O)O)CCC1C2CC[C@]2(C)C(C)CCC12 |
| InChI | InChI=1S/C21H28O2/c1-12-10-18-14(11-17(12)20(22)23)5-6-16-15(18)8-9-21(3)13(2)4-7-19(16)21/h10-11,13,15-16,19H,4-9H2,1-3H3,(H,22,23)/t13?,15?,16?,19?,21-/m1/s1 |
| InChIKey | UZTDQKJRIFAHRL-OKOJWHJISA-N |
| XLogP | 5.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |